What is more acidic fumaric acid or maleic acid?
What is more acidic fumaric acid or maleic acid?
Maleic acid is able to lose ion and it results in the formation of intra-hydrogen bond. Whereas fumaric acid being a trans isomer has strong interaction with both the oxygen atoms of each carboxylic group. That is why, maleic acid is a stronger acid than fumaric acid.
What is the pKa of fumaric acid?
3.03
Fumaric acid
| Names | |
|---|---|
| Solubility in water | 4.9 g/L at 20 °C |
| Acidity (pKa) | pka1 = 3.03, pka2 = 4.44 (15 °C, cis isomer) |
| Magnetic susceptibility (χ) | −49.11·10−6 cm3/mol |
| Dipole moment | non zero |
What is the pKa value for maleic acid?
3.2
Structure for FDB008114 (Malic acid)
| Property | Value | Source |
|---|---|---|
| logP | -0.87 | ALOGPS |
| logP | -1.1 | ChemAxon |
| logS | 0.21 | ALOGPS |
| pKa (Strongest Acidic) | 3.2 | ChemAxon |
Why is maleic acid more stable than fumaric acid?
When maleic acid loses hydrogen ion, then it forms a very strong intra-hydrogen bond so the acid is more stable and strong also. Also it contains two carboxyl groups on both sides so it is more stable while in fumaric acid, the carboxyl groups are at opposite ends…
What is the Iupac name of maleic acid?
cis-butenedioic acid
| IUPAC Name | (Z)-but-2-enedioic acid |
|---|---|
| Alternative Names | maleic acid cis-butenedioic acid |
| Molecular Formula | C4H4O4 |
| Molar Mass | 116.072 g/mol |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
Why is maleic acid more soluble in water?
Maleic acid is more soluble in water than fumaric acid. Both properties of maleic acid can be explained on account of the intramolecular hydrogen bonding that takes place in maleic acid at the expense of intermolecular interactions, and that are not possible in fumaric acid for geometric reasons.
What is the difference between the structure of maleic acid and fumaric acid?
The key difference between maleic acid and fumaric acid is that maleic acid is the cis-isomer of butenedioic acid, whereas fumaric acid is the trans-isomer. Moreover, maleic acid forms weak intramolecular hydrogen bonds and has a much lower melting point than fumaric acid.
What is the pKa of citric acid?
Citric acid is a tricarboxylic acid with a molecular weight of 210.14 Da. In view of its three carboxylic acid functional groups, it has three pKa values at pH 3.1, 4.7, and 6.4.
Why does malic acid have 2 pKa values?
The blue line represents the fraction of the acid that is unionized, the red line represents the singly-ionized acid, and the yellow line represents the doubly-ionized acid. Since malic and tartaric acid both have two protons which may be lost to the solution, there are two pKa values for each acid.
Which is more stable maleic or fumaric?
Note: The maleic acid or the cis-form of butenedioic acid is less stable than the Fumaric acid or the trans form of butenedioic acid. Maleic acid is soluble in water but Fumaric acid is not soluble in water.
What is the Iupac name of resorcinol?
Benzene-1,3-diol
Resorcinol/IUPAC ID
What is the difference between maleic acid and fumaric acid?
Maleic acid and fumaric acid are carboxylic acids. They are cis-trans isomers of each other. Both these compounds have two carboxylic acid groups per molecule. 1. Overview and Key Difference 2. What is Maleic Acid 3. What is Fumaric Acid 4. Side by Side Comparison – Maleic Acid vs Fumaric Acid in Tabular Form 5. Summary What is Maleic Acid?
Why does maleic acid not form extensive molecular networks?
Maleic acid cannot form such an extensive network no matter how much it distorts. It will be restricted to much less favourable crystal structures meaning weaker intermolecular attraction. In the liquid phase, fumaric acid will keep the near-sphere ordering somewhat intact, i.e. conserve a high number of hydrogen bonds to its neighbours.
Are intramolecular or intermolecular hydrogen bonds stronger in maleic acid?
The intermolcular hydrogen bonds in fumaric acid are said to be stronger than the intramolecular hydrogen bonds in maleic acid, while I thought that intramolecular hydrogen bonds should be stronger than intermolecular hydrogen bonds.
What are the values of PKA in organic chemistry?
pKa Data Compiled by R. Williams page-1 pKa Values INDEX Inorganic 2 Phenazine 24 Phosphates 3 Pyridine 25 Carboxylic acids 4, 8 Pyrazine 26 Aliphatic 4, 8 Aromatic 7, 8 Quinoline 27 Phenols 9 Quinazoline 27 Alcohols and oxygen acids 10, 11 Quinoxaline 27 Amino Acids 12 Special Nitrogen Compounds 28 Peptides 13 Hydroxylamines 28